C41H49N5O2 — CID 165000406
3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]-N-hexylpropanamide (PubChem CID 165000406) has the molecular formula C41H49N5O2 and a molecular weight of 643.88 g/mol. Its IUPAC name is 3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]-N-hexylpropanamide.
| Compound Name | 3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]-N-hexylpropanamide |
|---|---|
| PubChem CID | 165000406 |
| Molecular Formula | C41H49N5O2 |
| Molecular Weight | 643.88 g/mol |
| Exact Mass | 643.39 |
| IUPAC Name | 3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]-N-hexylpropanamide |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(C)=O)C(CCC(=O)NCCCCCC)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C41H49N5O2/c1-9-12-13-14-19-42-41(48)18-17-32-28(8)34-20-33-25(5)29(10-2)37(43-33)21-35-26(6)30(11-3)38(44-35)22-36-27(7)31(16-15-24(4)47)39(46-36)23-40(32)45-34/h10-11,20-23,43-44H,2-3,9,12-19H2,1,4-8H3,(H,42,48)/b33-20-,34-20-,35-21-,36-22-,37-21-,38-22-,39-23-,40-23- |
| InChIKey | GBGSPRSZIVSVSM-DHVSAAIRSA-N |
| XLogP | 9.92 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.88 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|