C38H41N5O4 — CID 165081238
(2S)-2-[3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoylamino]propanoic acid (PubChem CID 165081238) has the molecular formula C38H41N5O4 and a molecular weight of 631.78 g/mol. Its IUPAC name is (2S)-2-[3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 165081238 |
| Molecular Formula | C38H41N5O4 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.32 |
| IUPAC Name | (2S)-2-[3-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-oxobutyl)-22,23-dihydroporphyrin-2-yl]propanoylamino]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(C)=O)C(CCC(=O)N[C@@H](C)C(=O)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C38H41N5O4/c1-9-25-20(4)29-15-30-23(7)28(13-14-37(45)39-24(8)38(46)47)36(42-30)18-35-27(12-11-19(3)44)22(6)32(43-35)17-34-26(10-2)21(5)31(41-34)16-33(25)40-29/h9-10,15-18,24,40-41H,1-2,11-14H2,3-8H3,(H,39,45)(H,46,47)/b29-15-,30-15-,31-16-,32-17-,33-16-,34-17-,35-18-,36-18-/t24-/m0/s1 |
| InChIKey | HBXMDXJRHHWZJE-UKTJFHMLSA-N |
| XLogP | 7.82 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |