C38H43N6NaO3 — CID 23695011
sodium 3-[18-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 23695011) has the molecular formula C38H43N6NaO3 and a molecular weight of 654.79 g/mol. Its IUPAC name is sodium 3-[18-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | sodium 3-[18-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 23695011 |
| Molecular Formula | C38H43N6NaO3 |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.33 |
| IUPAC Name | sodium 3-[18-[3-[2-(dimethylamino)ethylamino]-3-oxopropyl]-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)NCCN(C)C)C(CCC(=O)[O-])=C4C)c(C)c3C=C.[Na+] |
| InChI | InChI=1S/C38H44N6O3.Na/c1-9-25-21(3)29-17-30-24(6)28(12-14-38(46)47)36(42-30)20-35-27(11-13-37(45)39-15-16-44(7)8)23(5)32(43-35)19-34-26(10-2)22(4)31(41-34)18-33(25)40-29;/h9-10,17-20,40-41H,1-2,11-16H2,3-8H3,(H,39,45)(H,46,47);/q;+1/p-1/b29-17-,30-17-,31-18-,32-19-,33-18-,34-19-,35-20-,36-20-; |
| InChIKey | OIKDIMMIVIZTNO-SBAYRDIXSA-M |
| XLogP | 3.07 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |