C38H50N6O4+2 — CID 10462617
[8,12-bis(2-carboxyethyl)-3,7,13,18-tetramethyl-17-[(trimethylazaniumyl)methyl]-22,23-dihydroporphyrin-2-yl]methyl-trimethylazanium (PubChem CID 10462617) has the molecular formula C38H50N6O4+2 and a molecular weight of 654.86 g/mol. Its IUPAC name is [8,12-bis(2-carboxyethyl)-3,7,13,18-tetramethyl-17-[(trimethylazaniumyl)methyl]-22,23-dihydroporphyrin-2-yl]methyl-trimethylazanium.
| Compound Name | [8,12-bis(2-carboxyethyl)-3,7,13,18-tetramethyl-17-[(trimethylazaniumyl)methyl]-22,23-dihydroporphyrin-2-yl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 10462617 |
| Molecular Formula | C38H50N6O4+2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.39 |
| IUPAC Name | [8,12-bis(2-carboxyethyl)-3,7,13,18-tetramethyl-17-[(trimethylazaniumyl)methyl]-22,23-dihydroporphyrin-2-yl]methyl-trimethylazanium |
| SMILES | CC1=C(C[N+](C)(C)C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5CCC(=O)O)c(CCC(=O)O)c4C)C(C[N+](C)(C)C)=C3C |
| InChI | InChI=1S/C38H48N6O4/c1-21-25(11-13-37(45)46)33-18-34-26(12-14-38(47)48)22(2)31(40-34)16-35-28(20-44(8,9)10)24(4)32(42-35)17-36-27(19-43(5,6)7)23(3)30(41-36)15-29(21)39-33/h15-18H,11-14,19-20H2,1-10H3,(H2-2,39,40,41,42,45,46,47,48)/p+2/b29-15-,30-15-,31-16-,32-17-,33-18-,34-18-,35-16-,36-17- |
| InChIKey | KRKZYFJKBDWVIX-MCQYKOTRSA-P |
| XLogP | 6.24 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|