C35H36N4O8 — CID 71695831
3,7,18-tris(2-carboxyethyl)-13-ethyl-8,12,17-trimethyl-21,23-dihydroporphyrin-2-carboxylic acid (PubChem CID 71695831) has the molecular formula C35H36N4O8 and a molecular weight of 640.69 g/mol. Its IUPAC name is 3,7,18-tris(2-carboxyethyl)-13-ethyl-8,12,17-trimethyl-21,23-dihydroporphyrin-2-carboxylic acid.
| Compound Name | 3,7,18-tris(2-carboxyethyl)-13-ethyl-8,12,17-trimethyl-21,23-dihydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 71695831 |
| Molecular Formula | C35H36N4O8 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 3,7,18-tris(2-carboxyethyl)-13-ethyl-8,12,17-trimethyl-21,23-dihydroporphyrin-2-carboxylic acid |
| SMILES | CCc1c(C)c2cc3nc(cc4[nH]c(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)c(C(=O)O)c4CCC(=O)O)C(CCC(=O)O)=C3C |
| InChI | InChI=1S/C35H36N4O8/c1-5-19-16(2)23-12-24-17(3)20(6-9-31(40)41)27(37-24)14-29-22(8-11-33(44)45)34(35(46)47)30(39-29)15-28-21(7-10-32(42)43)18(4)25(38-28)13-26(19)36-23/h12-15,36,39H,5-11H2,1-4H3,(H,40,41)(H,42,43)(H,44,45)(H,46,47)/b23-12-,24-12-,25-13-,26-13-,27-14-,28-15-,29-14-,30-15- |
| InChIKey | NDDYMIHSVLESGF-WTGCLDSASA-N |
| XLogP | 6.49 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |