C35H40N4O4 — CID 175667496
3-[18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17,21-pentamethyl-22H-porphyrin-2-yl]propanoic acid (PubChem CID 175667496) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17,21-pentamethyl-22H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17,21-pentamethyl-22H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 175667496 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17,21-pentamethyl-22H-porphyrin-2-yl]propanoic acid |
| SMILES | CCC1=C(C)c2cc3nc(cc4c(CCC(=O)O)c(C)c(cc5[nH]c(cc1n2)c(C)c5CC)n4C)C(CCC(=O)O)=C3C |
| InChI | InChI=1S/C35H40N4O4/c1-8-22-18(3)26-14-27-20(5)24(10-12-34(40)41)31(38-27)17-33-25(11-13-35(42)43)21(6)32(39(33)7)16-30-23(9-2)19(4)28(37-30)15-29(22)36-26/h14-17,37H,8-13H2,1-7H3,(H,40,41)(H,42,43)/b26-14-,27-14-,28-15-,29-15-,30-16-,31-17-,32-16-,33-17- |
| InChIKey | GVXXUUAPCGILEZ-XAPCCJBQSA-N |
| XLogP | 7.66 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |