C36H38N4O8Ru+3 — CID 11422811
ruthenium(3+);3-[8,12,18-tris(2-carboxyethyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 11422811) has the molecular formula C36H38N4O8Ru+3 and a molecular weight of 755.79 g/mol. Its IUPAC name is ruthenium(3+);3-[8,12,18-tris(2-carboxyethyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | ruthenium(3+);3-[8,12,18-tris(2-carboxyethyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 11422811 |
| Molecular Formula | C36H38N4O8Ru+3 |
| Molecular Weight | 755.79 g/mol |
| Exact Mass | 756.17 |
| IUPAC Name | ruthenium(3+);3-[8,12,18-tris(2-carboxyethyl)-3,7,13,17-tetramethyl-21,22-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCC(=O)O)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C)=C5CCC(=O)O)c(CCC(=O)O)c4C)c(C)c3CCC(=O)O.[Ru+3] |
| InChI | InChI=1S/C36H38N4O8.Ru/c1-17-21(5-9-33(41)42)29-15-30-23(7-11-35(45)46)19(3)27(39-30)14-28-20(4)24(8-12-36(47)48)32(40-28)16-31-22(6-10-34(43)44)18(2)26(38-31)13-25(17)37-29;/h13-16,37-38H,5-12H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48);/q;+3/b25-13-,26-13-,27-14-,28-14-,29-15-,30-15-,31-16-,32-16-; |
| InChIKey | RTSDMSXEEITONW-HMFWMICWSA-N |
| XLogP | 6.55 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.79 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |