C34H38N4O4S2 — CID 156620413
3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8,13-bis(2-sulfanylethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 156620413) has the molecular formula C34H38N4O4S2 and a molecular weight of 630.84 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8,13-bis(2-sulfanylethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8,13-bis(2-sulfanylethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 156620413 |
| Molecular Formula | C34H38N4O4S2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8,13-bis(2-sulfanylethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCS)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5CCC(=O)O)c(CCC(=O)O)c4C)C(CCS)=C3C |
| InChI | InChI=1S/C34H38N4O4S2/c1-17-21(5-7-33(39)40)31-16-32-22(6-8-34(41)42)18(2)27(38-32)14-30-24(10-12-44)20(4)28(37-30)15-29-23(9-11-43)19(3)26(35-29)13-25(17)36-31/h13-16,36,38,43-44H,5-12H2,1-4H3,(H,39,40)(H,41,42)/b25-13-,26-13-,27-14-,28-15-,29-15-,30-14-,31-16-,32-16- |
| InChIKey | AALSVFRLLQKYNA-UJYVZMRRSA-N |
| XLogP | 7.47 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|