C35H39F2N4O4Sn+ — CID 169069707
[13,17-bis(2-carboxyethyl)-2,7-diethyl-3,8,12,18,23-pentamethylporphyrin-21-yl]-difluorostannanylium (PubChem CID 169069707) has the molecular formula C35H39F2N4O4Sn+ and a molecular weight of 736.43 g/mol. Its IUPAC name is [13,17-bis(2-carboxyethyl)-2,7-diethyl-3,8,12,18,23-pentamethylporphyrin-21-yl]-difluorostannanylium.
| Compound Name | [13,17-bis(2-carboxyethyl)-2,7-diethyl-3,8,12,18,23-pentamethylporphyrin-21-yl]-difluorostannanylium |
|---|---|
| PubChem CID | 169069707 |
| Molecular Formula | C35H39F2N4O4Sn+ |
| Molecular Weight | 736.43 g/mol |
| Exact Mass | 737.20 |
| IUPAC Name | [13,17-bis(2-carboxyethyl)-2,7-diethyl-3,8,12,18,23-pentamethylporphyrin-21-yl]-difluorostannanylium |
| SMILES | CCC1=C(C)c2cc3c(C)c(CCC(=O)O)c(cc4nc(cc5c(CC)c(C)c(cc1n2)n5[Sn+](F)F)C(C)=C4CCC(=O)O)n3C |
| InChI | InChI=1S/C35H40N4O4.2FH.Sn/c1-8-22-18(3)26-14-30-23(9-2)19(4)28(38-30)16-32-21(6)25(11-13-35(42)43)33(39(32)7)17-31-24(10-12-34(40)41)20(5)27(37-31)15-29(22)36-26;;;/h14-17H,8-13H2,1-7H3,(H3,36,37,38,40,41,42,43);2*1H;/q;;;+4/p-3/b26-14-,27-15-,28-16-,29-15-,30-14-,31-17-,32-16-,33-17-;;; |
| InChIKey | RURCRZNOBKFPMJ-XYAILXQFSA-K |
| XLogP | 7.90 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.43 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |