C32H36N4O4 — CID 134839329
3-[18-(2-carboxyethyl)-3,7,12,17,21,23-hexamethyl-7,8-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 134839329) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-3,7,12,17,21,23-hexamethyl-7,8-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-3,7,12,17,21,23-hexamethyl-7,8-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134839329 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-3,7,12,17,21,23-hexamethyl-7,8-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCC(=O)O)c2cc3c(CCC(=O)O)c(C)c(cc4nc(cc5c(C)cc(cc1n2)n5C)CC4C)n3C |
| InChI | InChI=1S/C32H36N4O4/c1-17-11-21-13-28-18(2)12-22(35(28)5)14-26-19(3)23(7-9-31(37)38)27(34-26)16-30-24(8-10-32(39)40)20(4)29(36(30)6)15-25(17)33-21/h12-17H,7-11H2,1-6H3,(H,37,38)(H,39,40)/b21-13-,22-14-,25-15-,26-14-,27-16-,28-13-,29-15-,30-16- |
| InChIKey | GZISGXROZFDFCC-AJEQVHFESA-N |
| XLogP | 6.11 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |