C35H36N4O4 — CID 155487771
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17,21-pentamethyl-23H-porphyrin-2-yl]propanoic acid (PubChem CID 155487771) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17,21-pentamethyl-23H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17,21-pentamethyl-23H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 155487771 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17,21-pentamethyl-23H-porphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C(C)c2cc3c(C)c(CCC(=O)O)c(cc4nc(cc5[nH]c(cc1n2)c(C)c5C=C)C(C)=C4CCC(=O)O)n3C |
| InChI | InChI=1S/C35H36N4O4/c1-8-22-18(3)26-14-30-23(9-2)19(4)28(38-30)16-32-21(6)25(11-13-35(42)43)33(39(32)7)17-31-24(10-12-34(40)41)20(5)27(37-31)15-29(22)36-26/h8-9,14-17,36H,1-2,10-13H2,3-7H3,(H,40,41)(H,42,43)/b26-14-,27-15-,28-16-,29-15-,30-14-,31-17-,32-16-,33-17- |
| InChIKey | YXGFPMADAYTNSX-SXWJZWMKSA-N |
| XLogP | 7.51 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |