C35H36N4O4 — CID 173478654
3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-8-ethyl-3,13,17-trimethyl-21,22-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 173478654) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-8-ethyl-3,13,17-trimethyl-21,22-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-8-ethyl-3,13,17-trimethyl-21,22-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 173478654 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-8-ethyl-3,13,17-trimethyl-21,22-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C(C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CC)c5C=C)c(C)c4CCC(=O)O)C(CCC(=O)O)=C3C |
| InChI | InChI=1S/C35H36N4O4/c1-7-21-18(4)26-14-27-19(5)24(10-12-34(40)41)32(37-27)17-33-25(11-13-35(42)43)20(6)28(38-33)15-30-22(8-2)23(9-3)31(39-30)16-29(21)36-26/h7-8,14-17,38-39H,1-2,9-13H2,3-6H3,(H,40,41)(H,42,43)/b26-14-,27-14-,28-15-,29-16-,30-15-,31-16-,32-17-,33-17- |
| InChIKey | ROWGOKNEALJAOM-RYKNAGBNSA-N |
| XLogP | 7.76 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |