C40H38N4O16 — CID 137350095
3-[7,13,17-tris(2-carboxyethyl)-3,8,12,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 137350095) has the molecular formula C40H38N4O16 and a molecular weight of 830.76 g/mol. Its IUPAC name is 3-[7,13,17-tris(2-carboxyethyl)-3,8,12,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[7,13,17-tris(2-carboxyethyl)-3,8,12,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 137350095 |
| Molecular Formula | C40H38N4O16 |
| Molecular Weight | 830.76 g/mol |
| Exact Mass | 830.23 |
| IUPAC Name | 3-[7,13,17-tris(2-carboxyethyl)-3,8,12,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1=C(CC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CCC(=O)O)c5CC(=O)O)c(CCC(=O)O)c4CC(=O)O)C(CCC(=O)O)=C3CC(=O)O |
| InChI | InChI=1S/C40H38N4O16/c45-33(46)5-1-17-21(9-37(53)54)29-14-27-19(3-7-35(49)50)22(10-38(55)56)30(43-27)15-28-20(4-8-36(51)52)24(12-40(59)60)32(44-28)16-31-23(11-39(57)58)18(2-6-34(47)48)26(42-31)13-25(17)41-29/h13-16,41,43H,1-12H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16- |
| InChIKey | DDQSPZVDDLJUEK-UJJXFSCMSA-N |
| XLogP | 4.10 |
| TPSA | 355.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |