C38H42N4O8 — CID 177458242
methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,13-tetramethyl-22,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 177458242) has the molecular formula C38H42N4O8 and a molecular weight of 682.77 g/mol. Its IUPAC name is methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,13-tetramethyl-22,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,13-tetramethyl-22,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 177458242 |
| Molecular Formula | C38H42N4O8 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,12,13-tetramethyl-22,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(CC(=O)OC)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(CCC(=O)OC)c5CC(=O)OC)C(C)=C4C)c(C)c3C |
| InChI | InChI=1S/C38H42N4O8/c1-19-21(3)29-16-33-25(13-37(45)49-7)23(9-11-35(43)47-5)31(41-33)18-32-24(10-12-36(44)48-6)26(14-38(46)50-8)34(42-32)17-30-22(4)20(2)28(40-30)15-27(19)39-29/h15-18,39,42H,9-14H2,1-8H3/b27-15-,28-15-,29-16-,30-17-,31-18-,32-18-,33-16-,34-17- |
| InChIKey | UXJCIKFLEUJABH-CRTOKUQMSA-N |
| XLogP | 6.13 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|