C40H43F3N4O10 — CID 10629137
methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-21,24-dihydro-12H-porphyrin-2-yl]propanoate (PubChem CID 10629137) has the molecular formula C40H43F3N4O10 and a molecular weight of 796.80 g/mol. Its IUPAC name is methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-21,24-dihydro-12H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-21,24-dihydro-12H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10629137 |
| Molecular Formula | C40H43F3N4O10 |
| Molecular Weight | 796.80 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | methyl 3-[3,17-bis(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-7,8,13,13-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-21,24-dihydro-12H-porphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCc1c(CC(=O)OC)c2cc3nc(cc4nc(cc5[nH]c(cc1[nH]2)c(CCC(=O)OC)c5CC(=O)OC)C(C)(C)C4OC(=O)C(F)(F)F)C(C)=C3C |
| InChI | InChI=1S/C40H43F3N4O10/c1-19-20(2)26-16-31-37(57-38(52)40(41,42)43)39(3,4)32(47-31)18-30-24(14-36(51)56-8)22(10-12-34(49)54-6)28(46-30)17-27-21(9-11-33(48)53-5)23(13-35(50)55-7)29(45-27)15-25(19)44-26/h15-18,37,45-46H,9-14H2,1-8H3/b25-15-,26-16-,27-17-,28-17-,29-15-,30-18-,31-16-,32-18- |
| InChIKey | YLLLPUHNWOIIBY-VAMWZJOISA-N |
| XLogP | 6.03 |
| TPSA | 188.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.80 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|