C48H62N4O6 — CID 22213623
methyl 3-[8,13-bis(1-cyclohexyloxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 22213623) has the molecular formula C48H62N4O6 and a molecular weight of 791.05 g/mol. Its IUPAC name is methyl 3-[8,13-bis(1-cyclohexyloxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8,13-bis(1-cyclohexyloxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 22213623 |
| Molecular Formula | C48H62N4O6 |
| Molecular Weight | 791.05 g/mol |
| Exact Mass | 790.47 |
| IUPAC Name | methyl 3-[8,13-bis(1-cyclohexyloxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CCC(=O)OC)=C5C)c(C(C)OC1CCCCC1)c4C)c(C(C)OC1CCCCC1)c3C |
| InChI | InChI=1S/C48H62N4O6/c1-27-35(19-21-45(53)55-7)41-26-42-36(20-22-46(54)56-8)28(2)38(50-42)24-43-48(32(6)58-34-17-13-10-14-18-34)30(4)40(52-43)25-44-47(29(3)39(51-44)23-37(27)49-41)31(5)57-33-15-11-9-12-16-33/h23-26,31-34,51-52H,9-22H2,1-8H3/b37-23-,38-24-,39-23-,40-25-,41-26-,42-26-,43-24-,44-25- |
| InChIKey | YZRYPMBXAVSCND-JHKSQDDPSA-N |
| XLogP | 11.52 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.05 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |