C36H42N4O4 — CID 164679333
methyl 3-[7,12-diethyl-3-(3-methoxy-3-oxopropyl)-8,13,17,18-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 164679333) has the molecular formula C36H42N4O4 and a molecular weight of 594.76 g/mol. Its IUPAC name is methyl 3-[7,12-diethyl-3-(3-methoxy-3-oxopropyl)-8,13,17,18-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[7,12-diethyl-3-(3-methoxy-3-oxopropyl)-8,13,17,18-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 164679333 |
| Molecular Formula | C36H42N4O4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | methyl 3-[7,12-diethyl-3-(3-methoxy-3-oxopropyl)-8,13,17,18-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(CCC(=O)OC)=C5CCC(=O)OC)C(C)=C4C)c(C)c3CC |
| InChI | InChI=1S/C36H42N4O4/c1-9-23-21(5)29-15-27-19(3)20(4)28(37-27)16-33-25(11-13-35(41)43-7)26(12-14-36(42)44-8)34(40-33)18-32-24(10-2)22(6)30(39-32)17-31(23)38-29/h15-18,38-39H,9-14H2,1-8H3/b27-15-,28-16-,29-15-,30-17-,31-17-,32-18-,33-16-,34-18- |
| InChIKey | USPNAOLUFGSKKC-BEBVZDRYSA-N |
| XLogP | 7.82 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |