C41H43N5O6 — CID 10580588
methyl 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 10580588) has the molecular formula C41H43N5O6 and a molecular weight of 701.82 g/mol. Its IUPAC name is methyl 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10580588 |
| Molecular Formula | C41H43N5O6 |
| Molecular Weight | 701.82 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | methyl 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)Oc1ccccc1[N+](=O)[O-])C(CCC(=O)OC)=C4C)c(C)c3CC |
| InChI | InChI=1S/C41H43N5O6/c1-8-26-22(3)30-18-31-24(5)28(14-16-40(47)51-7)36(44-31)21-37-29(15-17-41(48)52-39-13-11-10-12-38(39)46(49)50)25(6)33(45-37)20-35-27(9-2)23(4)32(43-35)19-34(26)42-30/h10-13,18-21,42-43H,8-9,14-17H2,1-7H3/b30-18-,31-18-,32-19-,33-20-,34-19-,35-20-,36-21-,37-21- |
| InChIKey | WAAYRTZMJWIFDY-XLSCQNIZSA-N |
| XLogP | 9.17 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.82 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|