C43H56N4O4 — CID 10508854
methyl 3-[7,13-diethyl-10-heptyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 10508854) has the molecular formula C43H56N4O4 and a molecular weight of 692.94 g/mol. Its IUPAC name is methyl 3-[7,13-diethyl-10-heptyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[7,13-diethyl-10-heptyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10508854 |
| Molecular Formula | C43H56N4O4 |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.43 |
| IUPAC Name | methyl 3-[7,13-diethyl-10-heptyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCCCCCCc1c2nc(cc3[nH]c(cc4[nH]c(cc5nc1C(C)=C5CC)c(C)c4CCC(=O)OC)c(CCC(=O)OC)c3C)C(CC)=C2C |
| InChI | InChI=1S/C43H56N4O4/c1-10-13-14-15-16-17-33-42-27(6)29(11-2)36(46-42)22-34-25(4)31(18-20-40(48)50-8)38(44-34)24-39-32(19-21-41(49)51-9)26(5)35(45-39)23-37-30(12-3)28(7)43(33)47-37/h22-24,44-45H,10-21H2,1-9H3/b34-22-,35-23-,36-22-,37-23-,38-24-,39-24-,42-33-,43-33- |
| InChIKey | OOHZFRRKNUGPQM-QWJYDQMKSA-N |
| XLogP | 10.34 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|