C34H38N4O4 — CID 101477515
3-[18-(2-carboxyethyl)-10-ethyl-3,7,8,12,13,17-hexamethyl-21,24-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 101477515) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-10-ethyl-3,7,8,12,13,17-hexamethyl-21,24-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-10-ethyl-3,7,8,12,13,17-hexamethyl-21,24-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 101477515 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-10-ethyl-3,7,8,12,13,17-hexamethyl-21,24-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CCc1c2nc(cc3[nH]c(cc4[nH]c(cc5nc1C(C)=C5C)c(C)c4CCC(=O)O)c(CCC(=O)O)c3C)C(C)=C2C |
| InChI | InChI=1S/C34H38N4O4/c1-8-22-33-18(4)16(2)25(37-33)13-27-20(6)23(9-11-31(39)40)29(35-27)15-30-24(10-12-32(41)42)21(7)28(36-30)14-26-17(3)19(5)34(22)38-26/h13-15,35-36H,8-12H2,1-7H3,(H,39,40)(H,41,42)/b25-13-,26-14-,27-13-,28-14-,29-15-,30-15-,33-22-,34-22- |
| InChIKey | BRUADUSKCZIFOG-PEDFKWHDSA-N |
| XLogP | 7.43 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |