C34H34N4O4S2 — CID 135567236
3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-13-[(2R)-thiiran-2-yl]-8-[(2S)-thiiran-2-yl]-21,24-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 135567236) has the molecular formula C34H34N4O4S2 and a molecular weight of 626.80 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-13-[(2R)-thiiran-2-yl]-8-[(2S)-thiiran-2-yl]-21,24-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-13-[(2R)-thiiran-2-yl]-8-[(2S)-thiiran-2-yl]-21,24-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 135567236 |
| Molecular Formula | C34H34N4O4S2 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-13-[(2R)-thiiran-2-yl]-8-[(2S)-thiiran-2-yl]-21,24-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C([C@@H]2CS2)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C([C@H]1CS1)=C5C)c(C)c4CCC(=O)O)c(CCC(=O)O)c3C |
| InChI | InChI=1S/C34H34N4O4S2/c1-15-19(5-7-31(39)40)25-12-26-20(6-8-32(41)42)16(2)22(36-26)10-27-34(30-14-44-30)18(4)24(38-27)11-28-33(29-13-43-29)17(3)23(37-28)9-21(15)35-25/h9-12,29-30,35-36H,5-8,13-14H2,1-4H3,(H,39,40)(H,41,42)/b21-9-,22-10-,23-9-,24-11-,25-12-,26-12-,27-10-,28-11-/t29-,30+/m1/s1 |
| InChIKey | LHAVNOIYQFLDKS-HUXWYXISSA-N |
| XLogP | 7.06 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|