C34H36N4O4S2 — CID 170855681
3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8-[(1S)-1-sulfanylethyl]-13-[(2S)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 170855681) has the molecular formula C34H36N4O4S2 and a molecular weight of 628.82 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8-[(1S)-1-sulfanylethyl]-13-[(2S)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8-[(1S)-1-sulfanylethyl]-13-[(2S)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 170855681 |
| Molecular Formula | C34H36N4O4S2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-3,7,12,17-tetramethyl-8-[(1S)-1-sulfanylethyl]-13-[(2S)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCC(=O)O)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C([C@H]1CS1)=C5C)c([C@H](C)S)c4C)c(C)c3CCC(=O)O |
| InChI | InChI=1S/C34H36N4O4S2/c1-15-20(6-8-31(39)40)26-13-27-21(7-9-32(41)42)16(2)23(36-27)11-29-34(30-14-44-30)18(4)25(38-29)12-28-33(19(5)43)17(3)24(37-28)10-22(15)35-26/h10-13,19,30,35,37,43H,6-9,14H2,1-5H3,(H,39,40)(H,41,42)/b22-10-,23-11-,24-10-,25-12-,26-13-,27-13-,28-12-,29-11-/t19-,30+/m0/s1 |
| InChIKey | ZRFDILJQEBHMFC-BXEFQDSCSA-N |
| XLogP | 7.78 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|