C34H35N5O4S — CID 146035539
(E)-2-amino-3-[18-(2-carboxyethyl)-7-ethyl-3,8,13,17-tetramethyl-12-[(2R)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]prop-2-enoic acid (PubChem CID 146035539) has the molecular formula C34H35N5O4S and a molecular weight of 609.75 g/mol. Its IUPAC name is (E)-2-amino-3-[18-(2-carboxyethyl)-7-ethyl-3,8,13,17-tetramethyl-12-[(2R)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-amino-3-[18-(2-carboxyethyl)-7-ethyl-3,8,13,17-tetramethyl-12-[(2R)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146035539 |
| Molecular Formula | C34H35N5O4S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | (E)-2-amino-3-[18-(2-carboxyethyl)-7-ethyl-3,8,13,17-tetramethyl-12-[(2R)-thiiran-2-yl]-21,22-dihydroporphyrin-2-yl]prop-2-enoic acid |
| SMILES | CCc1c(C)c2cc3nc(cc4nc(cc5[nH]c(cc1[nH]2)c(C)c5/C=C(/N)C(=O)O)C(CCC(=O)O)=C4C)C(C)=C3[C@@H]1CS1 |
| InChI | InChI=1S/C34H35N5O4S/c1-6-19-15(2)25-12-30-33(31-14-44-31)18(5)26(39-30)10-23-16(3)20(7-8-32(40)41)28(37-23)13-29-21(9-22(35)34(42)43)17(4)24(38-29)11-27(19)36-25/h9-13,31,36,38H,6-8,14,35H2,1-5H3,(H,40,41)(H,42,43)/b22-9+,23-10-,24-11-,25-12-,26-10-,27-11-,28-13-,29-13-,30-12-/t31-/m0/s1 |
| InChIKey | ZNQGXGOHSMITHD-DYQCTZCDSA-N |
| XLogP | 6.72 |
| TPSA | 157.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|