C32H34N4O2 — CID 101337124
3-(12-ethenyl-3,7,8,10,13,17,18-heptamethyl-21,24-dihydroporphyrin-2-yl)propanoic acid (PubChem CID 101337124) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 3-(12-ethenyl-3,7,8,10,13,17,18-heptamethyl-21,24-dihydroporphyrin-2-yl)propanoic acid.
| Compound Name | 3-(12-ethenyl-3,7,8,10,13,17,18-heptamethyl-21,24-dihydroporphyrin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 101337124 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 3-(12-ethenyl-3,7,8,10,13,17,18-heptamethyl-21,24-dihydroporphyrin-2-yl)propanoic acid |
| SMILES | C=CC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(c(C)c1n2)C(C)=C5C)c(C)c4CCC(=O)O)c(C)c3C |
| InChI | InChI=1S/C32H34N4O2/c1-9-22-19(6)28-12-24-15(2)16(3)25(33-24)14-29-23(10-11-30(37)38)20(7)27(34-29)13-26-17(4)18(5)31(35-26)21(8)32(22)36-28/h9,12-14,33-34H,1,10-11H2,2-8H3,(H,37,38)/b24-12-,25-14-,26-13-,27-13-,28-12-,29-14-,31-21-,32-21- |
| InChIKey | FQWLAKRTMKALIB-IPLHATKGSA-N |
| XLogP | 7.63 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |