C42H42N4O4 — CID 10699601
methyl 3-[7,13-bis(ethenyl)-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-10-phenyl-21,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 10699601) has the molecular formula C42H42N4O4 and a molecular weight of 666.82 g/mol. Its IUPAC name is methyl 3-[7,13-bis(ethenyl)-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-10-phenyl-21,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[7,13-bis(ethenyl)-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-10-phenyl-21,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10699601 |
| Molecular Formula | C42H42N4O4 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | methyl 3-[7,13-bis(ethenyl)-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-10-phenyl-21,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | C=CC1=C(C)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2-c2ccccc2)C(C)=C4C=C)c(C)c3CCC(=O)OC)c(CCC(=O)OC)c1C |
| InChI | InChI=1S/C42H42N4O4/c1-9-28-25(5)41-40(27-14-12-11-13-15-27)42-26(6)29(10-2)35(46-42)21-33-24(4)31(17-19-39(48)50-8)37(44-33)22-36-30(16-18-38(47)49-7)23(3)32(43-36)20-34(28)45-41/h9-15,20-22,43-44H,1-2,16-19H2,3-8H3/b32-20-,33-21-,34-20-,35-21-,36-22-,37-22-,41-40-,42-40- |
| InChIKey | DECZXWRDSXLZAK-JVLGAOPZSA-N |
| XLogP | 9.04 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |