C53H46N4O7 — CID 10919972
methyl 3-[8,13,20-tribenzoyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 10919972) has the molecular formula C53H46N4O7 and a molecular weight of 850.97 g/mol. Its IUPAC name is methyl 3-[8,13,20-tribenzoyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8,13,20-tribenzoyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10919972 |
| Molecular Formula | C53H46N4O7 |
| Molecular Weight | 850.97 g/mol |
| Exact Mass | 850.34 |
| IUPAC Name | methyl 3-[8,13,20-tribenzoyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(c(C(=O)c6ccccc6)c1n2)C(CCC(=O)OC)=C5C)c(C(=O)c1ccccc1)c4C)c(C(=O)c1ccccc1)c3C |
| InChI | InChI=1S/C53H46N4O7/c1-29-36(22-24-44(58)63-5)49-48(53(62)35-20-14-9-15-21-35)50-37(23-25-45(59)64-6)30(2)39(57-50)27-42-47(52(61)34-18-12-8-13-19-34)32(4)41(55-42)28-43-46(51(60)33-16-10-7-11-17-33)31(3)40(54-43)26-38(29)56-49/h7-21,26-28,54-55H,22-25H2,1-6H3/b38-26-,39-27-,40-26-,41-28-,42-27-,43-28-,49-48+,50-48+ |
| InChIKey | DLNKQCZLBPZJHU-WSMXDPSHSA-N |
| XLogP | 10.39 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.97 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |