C37H40N4O2 — CID 177426174
methyl 3-(3,7,7,12,13,17,18-heptamethyl-10-phenyl-23,24-dihydro-8H-porphyrin-2-yl)propanoate (PubChem CID 177426174) has the molecular formula C37H40N4O2 and a molecular weight of 572.75 g/mol. Its IUPAC name is methyl 3-(3,7,7,12,13,17,18-heptamethyl-10-phenyl-23,24-dihydro-8H-porphyrin-2-yl)propanoate.
| Compound Name | methyl 3-(3,7,7,12,13,17,18-heptamethyl-10-phenyl-23,24-dihydro-8H-porphyrin-2-yl)propanoate |
|---|---|
| PubChem CID | 177426174 |
| Molecular Formula | C37H40N4O2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | methyl 3-(3,7,7,12,13,17,18-heptamethyl-10-phenyl-23,24-dihydro-8H-porphyrin-2-yl)propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3nc(c(-c4ccccc4)c4[nH]c(cc5[nH]c(cc1n2)c(C)c5C)c(C)c4C)CC3(C)C |
| InChI | InChI=1S/C37H40N4O2/c1-20-21(2)28-17-31-26(14-15-34(42)43-8)24(5)30(39-31)18-33-37(6,7)19-32(40-33)35(25-12-10-9-11-13-25)36-23(4)22(3)29(41-36)16-27(20)38-28/h9-13,16-18,38,41H,14-15,19H2,1-8H3/b27-16-,28-17-,29-16-,30-18-,31-17-,33-18-,35-32-,36-35- |
| InChIKey | BLYQYEQXIVVFGW-IUVNEIHSSA-N |
| XLogP | 8.62 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |