C35H40N4 — CID 164676793
3,3,7,8,10,13,13,17,18-nonamethyl-20-phenyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 164676793) has the molecular formula C35H40N4 and a molecular weight of 516.73 g/mol. Its IUPAC name is 3,3,7,8,10,13,13,17,18-nonamethyl-20-phenyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 3,3,7,8,10,13,13,17,18-nonamethyl-20-phenyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 164676793 |
| Molecular Formula | C35H40N4 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 3,3,7,8,10,13,13,17,18-nonamethyl-20-phenyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | Cc1c(C)c2[nH]c1cc1nc(c(-c3ccccc3)c3[nH]c(cc4nc(c2C)CC4(C)C)c(C)c3C)CC1(C)C |
| InChI | InChI=1S/C35H40N4/c1-19-21(3)32-23(5)27-17-34(6,7)29(36-27)16-26-20(2)22(4)33(39-26)31(24-13-11-10-12-14-24)28-18-35(8,9)30(37-28)15-25(19)38-32/h10-16,38-39H,17-18H2,1-9H3/b25-15-,26-16-,27-23-,29-16-,30-15-,31-28-,32-23-,33-31- |
| InChIKey | NOCHNKCHMLHWBB-AZAHAPDASA-N |
| XLogP | 8.56 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |