C48H38N4 — CID 135480013
2,7,12,17-tetramethyl-3,8,13,18-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 135480013) has the molecular formula C48H38N4 and a molecular weight of 670.86 g/mol. Its IUPAC name is 2,7,12,17-tetramethyl-3,8,13,18-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | 2,7,12,17-tetramethyl-3,8,13,18-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135480013 |
| Molecular Formula | C48H38N4 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 2,7,12,17-tetramethyl-3,8,13,18-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | CC1=C(c2ccccc2)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(-c1ccccc1)c5C)C(c1ccccc1)=C4C)c(-c1ccccc1)c3C |
| InChI | InChI=1S/C48H38N4/c1-29-37-25-42-46(34-19-11-6-12-20-34)31(3)39(50-42)27-44-48(36-23-15-8-16-24-36)32(4)40(52-44)28-43-47(35-21-13-7-14-22-35)30(2)38(51-43)26-41(49-37)45(29)33-17-9-5-10-18-33/h5-28,49,52H,1-4H3/b37-25-,38-26-,39-27-,40-28-,41-26-,42-25-,43-28-,44-27- |
| InChIKey | GXGNPHDEMUBOPH-LMWXFGCKSA-N |
| XLogP | 12.22 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |