C52H46N4 — CID 5245967
2,3,7,8,12,13,17,18-octamethyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin (PubChem CID 5245967) has the molecular formula C52H46N4 and a molecular weight of 726.97 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octamethyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octamethyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 5245967 |
| Molecular Formula | C52H46N4 |
| Molecular Weight | 726.97 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octamethyl-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
| SMILES | CC1=C(C)c2nc1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3[nH]c(c(C)c3C)c(-c3ccccc3)c3[nH]c(c(C)c3C)c2-c2ccccc2)C(C)=C1C |
| InChI | InChI=1S/C52H46N4/c1-29-30(2)46-42(38-23-15-10-16-24-38)48-33(5)34(6)50(55-48)44(40-27-19-12-20-28-40)52-36(8)35(7)51(56-52)43(39-25-17-11-18-26-39)49-32(4)31(3)47(54-49)41(45(29)53-46)37-21-13-9-14-22-37/h9-28,53-54H,1-8H3/b45-41-,46-42-,47-41-,48-42-,49-43-,50-44-,51-43-,52-44- |
| InChIKey | TWXQOOJEOIJKJN-PDTFSERUSA-N |
| XLogP | 14.12 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.97 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |