C34H34N4 — CID 12074461
2,3,7,8,12,13,17,18-octamethyl-15-phenyl-21,22-dihydroporphyrin (PubChem CID 12074461) has the molecular formula C34H34N4 and a molecular weight of 498.67 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octamethyl-15-phenyl-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octamethyl-15-phenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 12074461 |
| Molecular Formula | C34H34N4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octamethyl-15-phenyl-21,22-dihydroporphyrin |
| SMILES | CC1=C(C)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2-c2ccccc2)C(C)=C4C)c(C)c3C)c(C)c1C |
| InChI | InChI=1S/C34H34N4/c1-17-19(3)28-15-30-21(5)23(7)33(37-30)32(25-12-10-9-11-13-25)34-24(8)22(6)31(38-34)16-29-20(4)18(2)27(36-29)14-26(17)35-28/h9-16,35-36H,1-8H3/b26-14-,27-14-,28-15-,29-16-,30-15-,31-16-,33-32-,34-32- |
| InChIKey | XWCHLOVCEKLCAL-DLIAXIFZSA-N |
| XLogP | 9.12 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |