C39H40N4O4 — CID 10652224
methyl 2-[18-(2-methoxy-2-oxoethyl)-3,7,8,12,13,17-hexamethyl-10-(4-methylphenyl)-21,24-dihydroporphyrin-2-yl]acetate (PubChem CID 10652224) has the molecular formula C39H40N4O4 and a molecular weight of 628.77 g/mol. Its IUPAC name is methyl 2-[18-(2-methoxy-2-oxoethyl)-3,7,8,12,13,17-hexamethyl-10-(4-methylphenyl)-21,24-dihydroporphyrin-2-yl]acetate.
| Compound Name | methyl 2-[18-(2-methoxy-2-oxoethyl)-3,7,8,12,13,17-hexamethyl-10-(4-methylphenyl)-21,24-dihydroporphyrin-2-yl]acetate |
|---|---|
| PubChem CID | 10652224 |
| Molecular Formula | C39H40N4O4 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | methyl 2-[18-(2-methoxy-2-oxoethyl)-3,7,8,12,13,17-hexamethyl-10-(4-methylphenyl)-21,24-dihydroporphyrin-2-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2cc3nc(c(-c4ccc(C)cc4)c4nc(cc5[nH]c(cc1[nH]2)c(CC(=O)OC)c5C)C(C)=C4C)C(C)=C3C |
| InChI | InChI=1S/C39H40N4O4/c1-19-10-12-26(13-11-19)37-38-22(4)20(2)29(42-38)16-31-24(6)27(14-35(44)46-8)33(40-31)18-34-28(15-36(45)47-9)25(7)32(41-34)17-30-21(3)23(5)39(37)43-30/h10-13,16-18,40-41H,14-15H2,1-9H3/b29-16-,30-17-,31-16-,32-17-,33-18-,34-18-,38-37-,39-37- |
| InChIKey | WPKSMNIOJYNXOR-AOFIYHGUSA-N |
| XLogP | 8.24 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |