C41H46N4O2 — CID 101041340
4-(2,8-diethyl-3,7,13,17-tetramethyl-12,18-dipropyl-23,24-dihydroporphyrin-5-yl)benzoic acid (PubChem CID 101041340) has the molecular formula C41H46N4O2 and a molecular weight of 626.85 g/mol. Its IUPAC name is 4-(2,8-diethyl-3,7,13,17-tetramethyl-12,18-dipropyl-23,24-dihydroporphyrin-5-yl)benzoic acid.
| Compound Name | 4-(2,8-diethyl-3,7,13,17-tetramethyl-12,18-dipropyl-23,24-dihydroporphyrin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 101041340 |
| Molecular Formula | C41H46N4O2 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | 4-(2,8-diethyl-3,7,13,17-tetramethyl-12,18-dipropyl-23,24-dihydroporphyrin-5-yl)benzoic acid |
| SMILES | CCCc1c(C)c2cc3[nH]c(cc4nc(c(-c5ccc(C(=O)O)cc5)c5nc(cc1[nH]2)C(CC)=C5C)C(C)=C4CC)c(CCC)c3C |
| InChI | InChI=1S/C41H46N4O2/c1-9-13-30-22(5)32-19-33-23(6)31(14-10-2)37(43-33)21-35-29(12-4)25(8)40(45-35)38(26-15-17-27(18-16-26)41(46)47)39-24(7)28(11-3)34(44-39)20-36(30)42-32/h15-21,42-43H,9-14H2,1-8H3,(H,46,47)/b32-19-,33-19-,34-20-,35-21-,36-20-,37-21-,39-38-,40-38- |
| InChIKey | XQOAWGOZDUBPJM-LCVRAQKASA-N |
| XLogP | 10.88 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |