C44H50N4O6 — CID 10700129
methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 10700129) has the molecular formula C44H50N4O6 and a molecular weight of 730.91 g/mol. Its IUPAC name is methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10700129 |
| Molecular Formula | C44H50N4O6 |
| Molecular Weight | 730.91 g/mol |
| Exact Mass | 730.37 |
| IUPAC Name | methyl 3-[10-(2,5-dimethoxyphenyl)-7,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-21,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2-c2cc(OC)ccc2OC)C(C)=C4CC)c(C)c3CCC(=O)OC)c(CCC(=O)OC)c1C |
| InChI | InChI=1S/C44H50N4O6/c1-11-28-25(5)43-42(32-19-27(51-7)13-16-39(32)52-8)44-26(6)29(12-2)36(48-44)21-34-24(4)31(15-18-41(50)54-10)38(46-34)22-37-30(14-17-40(49)53-9)23(3)33(45-37)20-35(28)47-43/h13,16,19-22,45-46H,11-12,14-15,17-18H2,1-10H3/b33-20-,34-21-,35-20-,36-21-,37-22-,38-22-,43-42-,44-42- |
| InChIKey | WORMFSZPHFYERQ-AMASXFNZSA-N |
| XLogP | 9.51 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.91 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |