C36H41ClN4O4 — CID 46222717
methyl 3-[7-(2-chloroethyl)-17-ethyl-13-(3-methoxy-3-oxopropyl)-3,8,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate (PubChem CID 46222717) has the molecular formula C36H41ClN4O4 and a molecular weight of 629.20 g/mol. Its IUPAC name is methyl 3-[7-(2-chloroethyl)-17-ethyl-13-(3-methoxy-3-oxopropyl)-3,8,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[7-(2-chloroethyl)-17-ethyl-13-(3-methoxy-3-oxopropyl)-3,8,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 46222717 |
| Molecular Formula | C36H41ClN4O4 |
| Molecular Weight | 629.20 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | methyl 3-[7-(2-chloroethyl)-17-ethyl-13-(3-methoxy-3-oxopropyl)-3,8,12,18-tetramethyl-23,24-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3nc(cc4nc(cc5[nH]c(cc1[nH]2)c(CCC(=O)OC)c5C)C(C)=C4CCCl)C(C)=C3CCC(=O)OC |
| InChI | InChI=1S/C36H41ClN4O4/c1-8-23-19(2)29-16-32-24(9-11-35(42)44-6)21(4)30(41-32)17-33-26(13-14-37)22(5)28(39-33)15-27-20(3)25(10-12-36(43)45-7)34(40-27)18-31(23)38-29/h15-18,38,40H,8-14H2,1-7H3/b27-15-,28-15-,29-16-,30-17-,31-18-,32-16-,33-17-,34-18- |
| InChIKey | MNCAYYVGCSQTGZ-FWVVMQMQSA-N |
| XLogP | 8.04 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.20 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|