C39H43N5O4 — CID 11169988
methyl 3-[20-[(E)-2-cyanoethenyl]-8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 11169988) has the molecular formula C39H43N5O4 and a molecular weight of 645.80 g/mol. Its IUPAC name is methyl 3-[20-[(E)-2-cyanoethenyl]-8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[20-[(E)-2-cyanoethenyl]-8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 11169988 |
| Molecular Formula | C39H43N5O4 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | methyl 3-[20-[(E)-2-cyanoethenyl]-8,13-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(/C=C/C#N)c5nc(cc1[nH]2)C(C)=C5CCC(=O)OC)C(CCC(=O)OC)=C4C)c(C)c3CC |
| InChI | InChI=1S/C39H43N5O4/c1-9-25-21(3)30-18-32-23(5)27(13-15-36(45)47-7)38(43-32)29(12-11-17-40)39-28(14-16-37(46)48-8)24(6)33(44-39)20-35-26(10-2)22(4)31(42-35)19-34(25)41-30/h11-12,18-20,41-42H,9-10,13-16H2,1-8H3/b12-11+,30-18-,31-19-,32-18-,33-20-,34-19-,35-20-,38-29-,39-29- |
| InChIKey | NYPYXPVFSLREGQ-OBKQCWSJSA-N |
| XLogP | 8.36 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|