C33H40N4 — CID 635582
2,8,12,18-tetraethyl-3,7,13,15,17-pentamethyl-21,22-dihydroporphyrin (PubChem CID 635582) has the molecular formula C33H40N4 and a molecular weight of 492.71 g/mol. Its IUPAC name is 2,8,12,18-tetraethyl-3,7,13,15,17-pentamethyl-21,22-dihydroporphyrin.
| Compound Name | 2,8,12,18-tetraethyl-3,7,13,15,17-pentamethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 635582 |
| Molecular Formula | C33H40N4 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 2,8,12,18-tetraethyl-3,7,13,15,17-pentamethyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2C)C(C)=C4CC)c(CC)c3C)c(C)c1CC |
| InChI | InChI=1S/C33H40N4/c1-10-22-17(5)26-14-27-18(6)23(11-2)29(35-27)16-31-25(13-4)20(8)33(37-31)21(9)32-19(7)24(12-3)30(36-32)15-28(22)34-26/h14-16,34-35H,10-13H2,1-9H3/b26-14-,27-14-,28-15-,29-16-,30-15-,31-16-,32-21-,33-21- |
| InChIKey | RYTQLAGGOSVCTL-YNANQMKQSA-N |
| XLogP | 9.05 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |