C29H32N4 — CID 177428667
3,12-diethyl-2,7,13,17,18-pentamethyl-21,22-dihydroporphyrin (PubChem CID 177428667) has the molecular formula C29H32N4 and a molecular weight of 436.60 g/mol. Its IUPAC name is 3,12-diethyl-2,7,13,17,18-pentamethyl-21,22-dihydroporphyrin.
| Compound Name | 3,12-diethyl-2,7,13,17,18-pentamethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 177428667 |
| Molecular Formula | C29H32N4 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 3,12-diethyl-2,7,13,17,18-pentamethyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)cc5C)c(CC)c4C)C(C)=C3C |
| InChI | InChI=1S/C29H32N4/c1-8-21-18(6)26-13-24-16(4)17(5)25(31-24)14-27-19(7)22(9-2)29(33-27)12-23-15(3)10-20(30-23)11-28(21)32-26/h10-14,30,33H,8-9H2,1-7H3/b20-11-,23-12-,24-13-,25-14-,26-13-,27-14-,28-11-,29-12- |
| InChIKey | ZJCZRGTVKUVVMV-PKZODCSJSA-N |
| XLogP | 7.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |