C32H39N5 — CID 136851358
2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-23,24-dihydro-21H-porphyrin-5-imine (PubChem CID 136851358) has the molecular formula C32H39N5 and a molecular weight of 493.70 g/mol. Its IUPAC name is 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-23,24-dihydro-21H-porphyrin-5-imine.
| Compound Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-23,24-dihydro-21H-porphyrin-5-imine |
|---|---|
| PubChem CID | 136851358 |
| Molecular Formula | C32H39N5 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-23,24-dihydro-21H-porphyrin-5-imine |
| SMILES | [H]/N=c1\c2nc(cc3[nH]c(cc4[nH]c(cc5[nH]c1c(C)c5CC)c(CC)c4C)c(C)c3CC)C(CC)=C2C |
| InChI | InChI=1S/C32H39N5/c1-9-20-16(5)24-13-25-17(6)21(10-2)27(35-25)15-29-23(12-4)19(8)32(37-29)30(33)31-18(7)22(11-3)28(36-31)14-26(20)34-24/h13-15,33-36H,9-12H2,1-8H3/b24-13-,26-14-,29-15-,33-30- |
| InChIKey | GIKNBMBOCQDBSN-LJVIUDFUSA-N |
| XLogP | 7.96 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |