C35H42N4O — CID 10280227
(E)-3-(2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-23,24-dihydroporphyrin-5-yl)prop-2-en-1-ol (PubChem CID 10280227) has the molecular formula C35H42N4O and a molecular weight of 534.75 g/mol. Its IUPAC name is (E)-3-(2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-23,24-dihydroporphyrin-5-yl)prop-2-en-1-ol.
| Compound Name | (E)-3-(2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-23,24-dihydroporphyrin-5-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 10280227 |
| Molecular Formula | C35H42N4O |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | (E)-3-(2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-23,24-dihydroporphyrin-5-yl)prop-2-en-1-ol |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2/C=C/CO)C(CC)=C4C)c(CC)c3C)c(CC)c1C |
| InChI | InChI=1S/C35H42N4O/c1-9-23-20(6)29-17-33-25(11-3)22(8)34(39-33)27(14-13-15-40)35-26(12-4)21(7)30(38-35)18-32-24(10-2)19(5)28(36-32)16-31(23)37-29/h13-14,16-18,36-37,40H,9-12,15H2,1-8H3/b14-13+,28-16-,29-17-,30-18-,31-16-,32-18-,33-17-,34-27-,35-27- |
| InChIKey | AYPRJAQXMDZAEJ-RQGVZCOLSA-N |
| XLogP | 8.74 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |