C50H50N4O6 — CID 11411895
methyl 3-[18-(3-methoxy-3-oxopropyl)-8,13-bis[1-(4-methoxyphenyl)ethenyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 11411895) has the molecular formula C50H50N4O6 and a molecular weight of 802.97 g/mol. Its IUPAC name is methyl 3-[18-(3-methoxy-3-oxopropyl)-8,13-bis[1-(4-methoxyphenyl)ethenyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-8,13-bis[1-(4-methoxyphenyl)ethenyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 11411895 |
| Molecular Formula | C50H50N4O6 |
| Molecular Weight | 802.97 g/mol |
| Exact Mass | 802.37 |
| IUPAC Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-8,13-bis[1-(4-methoxyphenyl)ethenyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | C=C(c1ccc(OC)cc1)c1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)OC)C(CCC(=O)OC)=C4C)c(C)c3C(=C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C50H50N4O6/c1-27(33-11-15-35(57-7)16-12-33)49-31(5)41-23-39-29(3)37(19-21-47(55)59-9)43(51-39)26-44-38(20-22-48(56)60-10)30(4)40(52-44)24-45-50(32(6)42(54-45)25-46(49)53-41)28(2)34-13-17-36(58-8)18-14-34/h11-18,23-26,53-54H,1-2,19-22H2,3-10H3/b39-23-,40-24-,41-23-,42-25-,43-26-,44-26-,45-24-,46-25- |
| InChIKey | BGZTZKRUAZKZNT-RZELICSGSA-N |
| XLogP | 10.84 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.97 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |