C36H33F5N4O4 — CID 15432413
methyl 3-[8-(2,2-difluoroethenyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 15432413) has the molecular formula C36H33F5N4O4 and a molecular weight of 680.67 g/mol. Its IUPAC name is methyl 3-[8-(2,2-difluoroethenyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8-(2,2-difluoroethenyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 15432413 |
| Molecular Formula | C36H33F5N4O4 |
| Molecular Weight | 680.67 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | methyl 3-[8-(2,2-difluoroethenyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CCC(=O)OC)=C5C)c(C(F)=C(F)F)c4C)c(C=C(F)F)c3C |
| InChI | InChI=1S/C36H33F5N4O4/c1-16-20(7-9-32(46)48-5)27-15-28-21(8-10-33(47)49-6)17(2)25(43-28)14-30-34(35(39)36(40)41)19(4)26(45-30)13-29-22(11-31(37)38)18(3)24(44-29)12-23(16)42-27/h11-15,44-45H,7-10H2,1-6H3/b23-12-,24-12-,25-14-,26-13-,27-15-,28-15-,29-13-,30-14- |
| InChIKey | ARICMEDDWOQJFI-NGXFDERJSA-N |
| XLogP | 9.47 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.67 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |