C36H37F3N4O5 — CID 10746938
methyl 3-[8-(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 10746938) has the molecular formula C36H37F3N4O5 and a molecular weight of 662.71 g/mol. Its IUPAC name is methyl 3-[8-(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8-(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 10746938 |
| Molecular Formula | C36H37F3N4O5 |
| Molecular Weight | 662.71 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | methyl 3-[8-(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-13-(1,2,2-trifluoroethenyl)-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CCC(=O)OC)=C5C)c(C(F)=C(F)F)c4C)c(C(C)O)c3C |
| InChI | InChI=1S/C36H37F3N4O5/c1-16-21(8-10-31(45)47-6)27-15-28-22(9-11-32(46)48-7)17(2)24(41-28)13-30-34(35(37)36(38)39)19(4)26(43-30)14-29-33(20(5)44)18(3)25(42-29)12-23(16)40-27/h12-15,20,42-44H,8-11H2,1-7H3/b23-12-,24-13-,25-12-,26-14-,27-15-,28-15-,29-14-,30-13- |
| InChIKey | BUHVZHSJCBBFBN-MCELICPGSA-N |
| XLogP | 8.29 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.71 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |