C38H46N4O6 — CID 58091956
methyl 3-[18-(3-formyloxypropyl)-7,12-bis(1-methoxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 58091956) has the molecular formula C38H46N4O6 and a molecular weight of 654.81 g/mol. Its IUPAC name is methyl 3-[18-(3-formyloxypropyl)-7,12-bis(1-methoxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[18-(3-formyloxypropyl)-7,12-bis(1-methoxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 58091956 |
| Molecular Formula | C38H46N4O6 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | methyl 3-[18-(3-formyloxypropyl)-7,12-bis(1-methoxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CCCOC=O)=C5C)c(C)c4C(C)OC)c(C)c3C(C)OC |
| InChI | InChI=1S/C38H46N4O6/c1-20-26(11-10-14-48-19-43)32-18-33-27(12-13-36(44)47-9)21(2)29(40-33)16-34-38(25(6)46-8)23(4)31(42-34)17-35-37(24(5)45-7)22(3)30(41-35)15-28(20)39-32/h15-19,24-25,41-42H,10-14H2,1-9H3/b28-15-,29-16-,30-15-,31-17-,32-18-,33-18-,34-16-,35-17- |
| InChIKey | GLKQEQOQSIRMAE-IMTJAKLVSA-N |
| XLogP | 8.11 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|