C44H58N4O5S — CID 101498013
3-[3,7,12,17-tetramethyl-18-(3-oxo-3-sulfanylpropyl)-8,13-bis(1-pentoxyethyl)-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 101498013) has the molecular formula C44H58N4O5S and a molecular weight of 755.04 g/mol. Its IUPAC name is 3-[3,7,12,17-tetramethyl-18-(3-oxo-3-sulfanylpropyl)-8,13-bis(1-pentoxyethyl)-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[3,7,12,17-tetramethyl-18-(3-oxo-3-sulfanylpropyl)-8,13-bis(1-pentoxyethyl)-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 101498013 |
| Molecular Formula | C44H58N4O5S |
| Molecular Weight | 755.04 g/mol |
| Exact Mass | 754.41 |
| IUPAC Name | 3-[3,7,12,17-tetramethyl-18-(3-oxo-3-sulfanylpropyl)-8,13-bis(1-pentoxyethyl)-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CCCCCOC(C)c1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)S)C(CCC(=O)O)=C4C)c(C)c3C(C)OCCCCC |
| InChI | InChI=1S/C44H58N4O5S/c1-9-11-13-19-52-29(7)43-27(5)35-21-33-25(3)31(15-17-41(49)50)37(45-33)24-38-32(16-18-42(51)54)26(4)34(46-38)22-39-44(30(8)53-20-14-12-10-2)28(6)36(48-39)23-40(43)47-35/h21-24,29-30,47-48H,9-20H2,1-8H3,(H,49,50)(H,51,54)/b33-21-,34-22-,35-21-,36-23-,37-24-,38-24-,39-22-,40-23- |
| InChIKey | BIPWJDWBXORLMI-OKYITIEZSA-N |
| XLogP | 11.43 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.04 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|