C42H56N6O4S2 — CID 10078923
3-[18-(2-carboxyethyl)-8,13-bis[1-[2-(dimethylamino)ethylsulfanyl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 10078923) has the molecular formula C42H56N6O4S2 and a molecular weight of 773.08 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis[1-[2-(dimethylamino)ethylsulfanyl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis[1-[2-(dimethylamino)ethylsulfanyl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 10078923 |
| Molecular Formula | C42H56N6O4S2 |
| Molecular Weight | 773.08 g/mol |
| Exact Mass | 772.38 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis[1-[2-(dimethylamino)ethylsulfanyl]ethyl]-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5C(C)SCCN(C)C)c(C)c4C(C)SCCN(C)C)C(C)=C3CCC(=O)O |
| InChI | InChI=1S/C42H56N6O4S2/c1-23-29(11-13-39(49)50)35-22-36-30(12-14-40(51)52)24(2)32(44-36)20-37-42(28(6)54-18-16-48(9)10)26(4)34(46-37)21-38-41(27(5)53-17-15-47(7)8)25(3)33(45-38)19-31(23)43-35/h19-22,27-28,45-46H,11-18H2,1-10H3,(H,49,50)(H,51,52)/b31-19-,32-20-,33-19-,34-21-,35-22-,36-22-,37-20-,38-21- |
| InChIKey | BIVJEHIEQYRWNF-HXJOAWKQSA-N |
| XLogP | 9.23 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.08 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |