C43H56N4O9 — CID 157113373
3-[18-(2-carboxyethyl)-8-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,7,12,17-tetramethyl-13-[1-(2-propoxyethoxy)ethyl]-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 157113373) has the molecular formula C43H56N4O9 and a molecular weight of 772.94 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,7,12,17-tetramethyl-13-[1-(2-propoxyethoxy)ethyl]-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-8-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,7,12,17-tetramethyl-13-[1-(2-propoxyethoxy)ethyl]-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 157113373 |
| Molecular Formula | C43H56N4O9 |
| Molecular Weight | 772.94 g/mol |
| Exact Mass | 772.40 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,7,12,17-tetramethyl-13-[1-(2-propoxyethoxy)ethyl]-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | CCCOCCOC(C)c1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3C(C)OCCOCCO |
| InChI | InChI=1S/C43H56N4O9/c1-8-14-53-16-18-55-29(7)43-27(5)35-22-39-42(28(6)56-19-17-54-15-13-48)26(4)34(46-39)20-32-24(2)30(9-11-40(49)50)36(44-32)23-37-31(10-12-41(51)52)25(3)33(45-37)21-38(43)47-35/h20-23,28-29,46-48H,8-19H2,1-7H3,(H,49,50)(H,51,52)/b32-20-,33-21-,34-20-,35-22-,36-23-,37-23-,38-21-,39-22- |
| InChIKey | LDPNITILYYHYLP-ZOOSZHOOSA-N |
| XLogP | 8.11 |
| TPSA | 189.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.94 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|