C44H63N5O9 — CID 67877621
3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol;1-propoxypropane (PubChem CID 67877621) has the molecular formula C44H63N5O9 and a molecular weight of 806.01 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol;1-propoxypropane.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol;1-propoxypropane |
|---|---|
| PubChem CID | 67877621 |
| Molecular Formula | C44H63N5O9 |
| Molecular Weight | 806.01 g/mol |
| Exact Mass | 805.46 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol;1-propoxypropane |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5C(C)O)c(C)c4C(C)O)C(C)=C3CCC(=O)O.CCCOCCC.OCCNCCO |
| InChI | InChI=1S/C34H38N4O6.C6H14O.C4H11NO2/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27;1-3-5-7-6-4-2;6-3-1-5-2-4-7/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44);3-6H2,1-2H3;5-7H,1-4H2/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13-;; |
| InChIKey | QHJNKUUVIPIVKX-UDHHKLSBSA-N |
| XLogP | 7.01 |
| TPSA | 234.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.01 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|