C40H50N4O6 — CID 67887958
3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;bis(prop-1-ene) (PubChem CID 67887958) has the molecular formula C40H50N4O6 and a molecular weight of 682.86 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;bis(prop-1-ene).
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;bis(prop-1-ene) |
|---|---|
| PubChem CID | 67887958 |
| Molecular Formula | C40H50N4O6 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.37 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.CC1=C(CCC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5C(C)O)c(C)c4C(C)O)C(C)=C3CCC(=O)O |
| InChI | InChI=1S/C34H38N4O6.2C3H6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27;2*1-3-2/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44);2*3H,1H2,2H3/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13-;; |
| InChIKey | CCSGZJGPXCVSMH-UDHHKLSBSA-N |
| XLogP | 9.01 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|