C55H56N4O2 — CID 14481735
3,7-dibutyl-15-[3-[6-[3-(dimethoxymethyl)phenyl]hexa-1,3,5-triynyl]phenyl]-2,8,12,13,17,18-hexamethyl-21,22-dihydroporphyrin (PubChem CID 14481735) has the molecular formula C55H56N4O2 and a molecular weight of 805.08 g/mol. Its IUPAC name is 3,7-dibutyl-15-[3-[6-[3-(dimethoxymethyl)phenyl]hexa-1,3,5-triynyl]phenyl]-2,8,12,13,17,18-hexamethyl-21,22-dihydroporphyrin.
| Compound Name | 3,7-dibutyl-15-[3-[6-[3-(dimethoxymethyl)phenyl]hexa-1,3,5-triynyl]phenyl]-2,8,12,13,17,18-hexamethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 14481735 |
| Molecular Formula | C55H56N4O2 |
| Molecular Weight | 805.08 g/mol |
| Exact Mass | 804.44 |
| IUPAC Name | 3,7-dibutyl-15-[3-[6-[3-(dimethoxymethyl)phenyl]hexa-1,3,5-triynyl]phenyl]-2,8,12,13,17,18-hexamethyl-21,22-dihydroporphyrin |
| SMILES | CCCCc1c(C)c2cc3nc(c(-c4cccc(C#CC#CC#Cc5cccc(C(OC)OC)c5)c4)c4nc(cc5[nH]c(cc1[nH]2)c(CCCC)c5C)C(C)=C4C)C(C)=C3C |
| InChI | InChI=1S/C55H56N4O2/c1-11-13-27-44-38(7)48-31-46-34(3)36(5)53(58-46)52(42-25-19-23-40(29-42)21-17-15-16-18-22-41-24-20-26-43(30-41)55(60-9)61-10)54-37(6)35(4)47(59-54)32-49-39(8)45(28-14-12-2)51(57-49)33-50(44)56-48/h19-20,23-26,29-33,55-57H,11-14,27-28H2,1-10H3/b46-31-,47-32-,48-31-,49-32-,50-33-,51-33-,53-52-,54-52- |
| InChIKey | VLNJIYOADIZJAS-RSLHIUKXSA-N |
| XLogP | 12.88 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.08 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|